CymitQuimica logo

CAS 884048-45-7

:

(3S,4R)-1-(tert-butoxycarbonyl)-4-phenylpyrrolidine-3-carboxylic acid

Description:
The chemical substance known as (3S,4R)-1-(tert-butoxycarbonyl)-4-phenylpyrrolidine-3-carboxylic acid, with the CAS number 884048-45-7, is a chiral pyrrolidine derivative that features a tert-butoxycarbonyl (Boc) protecting group and a phenyl substituent. This compound is characterized by its specific stereochemistry, indicated by the (3S,4R) configuration, which plays a crucial role in its biological activity and interactions. The presence of the carboxylic acid functional group contributes to its acidity and potential reactivity in various chemical reactions, including peptide synthesis and other organic transformations. The tert-butoxycarbonyl group serves as a protective group, allowing for selective reactions at other functional sites. This compound is of interest in medicinal chemistry and drug development, particularly in the synthesis of peptide-based therapeutics. Its solubility and stability can vary depending on the solvent and conditions, making it important to consider these factors in practical applications. Overall, this compound exemplifies the complexity and utility of chiral molecules in organic synthesis and pharmaceutical research.
Formula:C16H21NO4
InChI:InChI=1/C16H21NO4/c1-16(2,3)21-15(20)17-9-12(13(10-17)14(18)19)11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3,(H,18,19)
InChI key:KEWYECRQALNJJM-QWHCGFSZSA-N
SMILES:CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)C(=O)O)C2=CC=CC=C2
Synonyms:
  • 1-[(Tert-Butyl)Oxycarbonyl]-4-Phenylpyrroline-3-Carboxylic Acid
  • 1-(tert-butoxycarbonyl)-4-phenylpyrrolidine-3-carboxylic acid
Found 4 products.