CymitQuimica logo

CAS 88405-88-3

:

2,4-Hexadienedioic acid, 2,3-dichloro-, 6-methyl ester, (Z,E)-

Description:
2,4-Hexadienedioic acid, 2,3-dichloro-, 6-methyl ester, commonly referred to by its CAS number 88405-88-3, is an organic compound characterized by its unique structure featuring a hexadienoic acid backbone with two double bonds and ester functional groups. The presence of dichloro substituents at the 2 and 3 positions, along with a methyl group at the 6 position, contributes to its reactivity and potential applications in various chemical processes. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific formulation and purity. It exhibits properties such as solubility in organic solvents and potential reactivity with nucleophiles due to the presence of the double bonds and ester functionalities. The (Z,E) notation indicates the specific geometric isomerism of the double bonds, which can influence its chemical behavior and interactions. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health and environmental risks.
Formula:C7H6Cl2O4
InChI:InChI=1S/C7H6Cl2O4/c1-13-5(10)3-2-4(8)6(9)7(11)12/h2-3H,1H3,(H,11,12)/p-1
InChI key:UUFUICORAWVCME-UHFFFAOYSA-M
SMILES:COC(=O)C=CC(=C(C(=O)[O-])Cl)Cl
Found 1 products.