CymitQuimica logo

CAS 884058-04-2

:

5-(chloromethyl)-3-isopentyl-1,2,4-oxadiazole

Description:
5-(Chloromethyl)-3-isopentyl-1,2,4-oxadiazole is a chemical compound characterized by its unique oxadiazole ring structure, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. The presence of a chloromethyl group enhances its reactivity, making it a potential intermediate in organic synthesis. The isopentyl substituent contributes to its hydrophobic properties, influencing its solubility and interaction with biological systems. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in agrochemicals or as a building block in the synthesis of more complex molecules. The compound's stability, reactivity, and potential toxicity would need to be evaluated in detail for practical applications. As with many synthetic organic compounds, safety data and handling precautions are essential due to the presence of chlorine, which can pose environmental and health risks. Overall, 5-(chloromethyl)-3-isopentyl-1,2,4-oxadiazole represents a versatile structure in the realm of organic chemistry.
Formula:C6H9ClN2O
InChI:InChI=1/C6H9ClN2O/c1-2-3-5-8-6(4-7)10-9-5/h2-4H2,1H3
InChI key:GBSUHSDLMMIZEP-UHFFFAOYSA-N
SMILES:CCCc1nc(CCl)on1
Synonyms:
  • 5-(Chloromethyl)-3-Propyl-1,2,4-Oxadiazole
Found 3 products.