CymitQuimica logo

CAS 88422-90-6

:

Isoquinoline, 1-(ethoxymethyl)-3,4-dihydro-

Description:
Isoquinoline, 1-(ethoxymethyl)-3,4-dihydro- is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound derived from quinoline. This specific derivative features an ethoxymethyl group, contributing to its unique properties. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It exhibits moderate solubility in organic solvents, while its solubility in water is limited due to the hydrophobic nature of the isoquinoline ring. Isoquinoline derivatives are known for their biological activity, often serving as precursors in the synthesis of pharmaceuticals and agrochemicals. The presence of the ethoxymethyl group may influence its reactivity and interaction with biological targets. Additionally, the compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with anti-inflammatory or analgesic properties. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H15NO
InChI:InChI=1S/C12H15NO/c1-2-14-9-12-11-6-4-3-5-10(11)7-8-13-12/h3-6H,2,7-9H2,1H3
InChI key:NENUROUAIGJZTN-UHFFFAOYSA-N
SMILES:CCOCC1=NCCC2=CC=CC=C21
Found 1 products.