CymitQuimica logo

CAS 884494-54-6

:

2-chloro-5-fluoro-pyridine-4-carbaldehyde

Description:
2-Chloro-5-fluoro-pyridine-4-carbaldehyde is a heterocyclic organic compound characterized by its pyridine ring, which contains both a chlorine and a fluorine substituent, as well as an aldehyde functional group. The presence of the chlorine atom at the 2-position and the fluorine atom at the 5-position of the pyridine ring influences its reactivity and polarity, making it a valuable intermediate in organic synthesis. The aldehyde group at the 4-position contributes to its potential as a reactive electrophile, allowing for various chemical transformations, such as nucleophilic additions. This compound is typically used in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique electronic properties and structural features. Additionally, its molecular structure may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-chloro-5-fluoro-pyridine-4-carbaldehyde is a versatile compound with significant applications in chemical research and industry.
Formula:C6H3ClFNO
InChI:InChI=1/C6H3ClFNO/c7-6-1-4(3-10)5(8)2-9-6/h1-3H
InChI key:SUXQRZZPWPDIIN-UHFFFAOYSA-N
SMILES:c1c(C=O)c(cnc1Cl)F
Synonyms:
  • 2-Chloro-5-fluoroisonicotinaldehyde
  • 4-Pyridinecarboxaldehyde, 2-Chloro-5-Fluoro-
  • 2-Chloro-5-fluoro-4-formylpyridine
Found 4 products.