CymitQuimica logo

CAS 884494-74-0

:

2-Chloro-5-fluoro-4-pyridinecarboxylic acid

Description:
2-Chloro-5-fluoro-4-pyridinecarboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which contains both chlorine and fluorine substituents, as well as a carboxylic acid functional group. The presence of the chlorine atom at the 2-position and the fluorine atom at the 5-position of the pyridine ring contributes to its unique chemical reactivity and potential applications in pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and exhibits moderate solubility in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. Its molecular structure allows for various interactions, making it a candidate for further chemical modifications. The compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on the conditions and the presence of other functional groups in a reaction. Overall, 2-Chloro-5-fluoro-4-pyridinecarboxylic acid is of interest in synthetic organic chemistry and medicinal chemistry for its potential biological activity.
Formula:C6H3ClFNO2
InChI:InChI=1S/C6H3ClFNO2/c7-5-1-3(6(10)11)4(8)2-9-5/h1-2H,(H,10,11)
InChI key:InChIKey=MEDPACAROROBNJ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(F)=CN=C(Cl)C1
Synonyms:
  • 2-Chloro-5-fluoro-4-pyridinecarboxylic acid
  • 2-Chloro-5-fluoroisonicotinic acid
  • 2-Chloro-5-fluoropyridine-4-carboxylic acid
  • 4-Pyridinecarboxylic acid, 2-chloro-5-fluoro-
Found 4 products.