CAS 884502-23-2
:2H-Indazole-6-carboxylicacid, 2-butyl-3-methoxy-
Description:
2H-Indazole-6-carboxylic acid, 2-butyl-3-methoxy- is an organic compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a carboxylic acid functional group, which contributes to its acidity and potential for forming salts and esters. The presence of a butyl group and a methoxy group enhances its hydrophobic characteristics and may influence its solubility and reactivity. The methoxy group, in particular, can participate in various chemical reactions, such as methylation or ether formation. The compound's structure suggests potential applications in pharmaceuticals or agrochemicals, as indazole derivatives are often explored for their biological activities. Additionally, the specific arrangement of substituents can affect the compound's physical properties, such as melting point, boiling point, and spectral characteristics. Overall, 2H-Indazole-6-carboxylic acid, 2-butyl-3-methoxy- is a complex molecule with diverse potential applications in chemical research and industry.
Formula:C13H16N2O3
InChI:InChI=1S/C13H16N2O3/c1-3-4-7-15-12(18-2)10-6-5-9(13(16)17)8-11(10)14-15/h5-6,8H,3-4,7H2,1-2H3,(H,16,17)
InChI key:KYYWAAGEGIYTNB-UHFFFAOYSA-N
SMILES:CCCCN1C(=C2C=CC(=CC2=N1)C(=O)O)OC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
