CymitQuimica logo

CAS 884507-40-8

:

N-methyl-1-[4-(pyrrolidin-1-ylmethyl)phenyl]methanamine

Description:
N-methyl-1-[4-(pyrrolidin-1-ylmethyl)phenyl]methanamine, identified by its CAS number 884507-40-8, is a chemical compound that belongs to the class of substituted phenylmethanamines. This substance features a central amine group, which is substituted with a methyl group and a phenyl ring that is further substituted with a pyrrolidine moiety. The presence of the pyrrolidine ring suggests potential for interactions with biological systems, possibly influencing its pharmacological properties. The compound is likely to exhibit basic characteristics due to the amine functional group, which can participate in hydrogen bonding and protonation. Its structure may confer lipophilicity, allowing for membrane permeability, which is a critical factor in drug design. Additionally, the presence of both aromatic and aliphatic components may contribute to its stability and reactivity. As with many amines, it may also be sensitive to oxidation and can undergo various chemical reactions typical of amines, such as alkylation or acylation. Overall, the unique structural features of this compound suggest potential applications in medicinal chemistry and pharmacology.
Formula:C13H20N2
InChI:InChI=1/C13H20N2/c1-14-10-12-4-6-13(7-5-12)11-15-8-2-3-9-15/h4-7,14H,2-3,8-11H2,1H3
InChI key:PJTVZWBZDHZISX-UHFFFAOYSA-N
SMILES:CNCc1ccc(cc1)CN1CCCC1
Synonyms:
  • benzenemethanamine, N-methyl-4-(1-pyrrolidinylmethyl)-
  • N-Methyl-1-[4-(pyrrolidin-1-ylmethyl)phenyl]methanamine
Found 3 products.