CAS 88469-75-4
:Thiazolo[4,5-d]pyridazin-7(6H)-one, 2,6-diphenyl-
Description:
Thiazolo[4,5-d]pyridazin-7(6H)-one, 2,6-diphenyl- is a heterocyclic compound characterized by its unique bicyclic structure that incorporates both thiazole and pyridazine moieties. This compound features a thiazole ring fused to a pyridazine ring, with a carbonyl group at the 7-position and two phenyl groups at the 2 and 6 positions of the pyridazine ring. The presence of these aromatic phenyl substituents contributes to its potential for various applications in organic synthesis and medicinal chemistry. The compound may exhibit interesting biological activities, making it a subject of research in pharmacology. Its molecular structure allows for potential interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the compound's stability and solubility characteristics can vary based on the specific conditions and solvents used, influencing its reactivity and applications in chemical processes. Overall, Thiazolo[4,5-d]pyridazin-7(6H)-one, 2,6-diphenyl- represents a class of compounds with significant potential in various fields of chemistry and drug development.
Formula:C17H11N3OS
InChI:InChI=1S/C17H11N3OS/c21-17-15-14(11-18-20(17)13-9-5-2-6-10-13)19-16(22-15)12-7-3-1-4-8-12/h1-11H
InChI key:ZQYRSOQQDOAQRY-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=NC3=C(S2)C(=O)N(N=C3)C4=CC=CC=C4
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
