CymitQuimica logo

CAS 885068-10-0

:

6-Indazolyboronic acid

Description:
6-Indazolyboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to an indazole ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The boronic acid moiety allows for the formation of reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. It can participate in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the synthesis of complex organic molecules. Additionally, 6-Indazolyboronic acid may exhibit biological activity, potentially serving as a pharmacophore in drug development. Its unique structural features contribute to its reactivity and utility in synthetic organic chemistry, particularly in the development of new therapeutic agents and functional materials. As with many boronic acids, care must be taken in handling due to their sensitivity to moisture and air, which can affect their stability and reactivity.
Formula:C7H7BN2O2
InChI:InChI=1/C7H7BN2O2/c11-8(12)6-2-1-5-4-9-10-7(5)3-6/h1-4,11-12H,(H,9,10)
InChI key:ZKNLCHWRWRYPGG-UHFFFAOYSA-N
SMILES:c1cc(cc2c1c[nH]n2)B(O)O
Synonyms:
  • 1H-Indazole-6-boronic acid
  • 1H-indazol-6-ylboronic acid
  • (1H-indazol-6-yl)boronic acid
Found 5 products.