CymitQuimica logo

CAS 885269-69-2

:

Carbamic acid,[(4-aminotetrahydro-2H-pyran-4-yl)methyl]-, 1,1-dimethylethyl ester (9CI)

Description:
Carbamic acid, [(4-aminotetrahydro-2H-pyran-4-yl)methyl]-, 1,1-dimethylethyl ester, with the CAS number 885269-69-2, is a chemical compound characterized by its carbamate functional group, which is derived from carbamic acid. This compound features a tetrahydro-pyran ring, contributing to its cyclic structure and potential for various interactions. The presence of the amino group indicates that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The tert-butyl ester group suggests that it may exhibit hydrophobic characteristics, influencing its overall solubility and reactivity. This compound may be of interest in medicinal chemistry due to its structural features, which could impart biological activity. Additionally, its stability and reactivity can be influenced by the steric hindrance provided by the dimethyl groups. Overall, this compound's unique structure may allow for diverse applications in pharmaceuticals or agrochemicals, although specific biological or chemical properties would require further investigation.
Formula:C11H22N2O3
InChI:InChI=1S/C11H22N2O3/c1-10(2,3)16-9(14)13-8-11(12)4-6-15-7-5-11/h4-8,12H2,1-3H3,(H,13,14)
InChI key:OKKXSYCQUVNYBS-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NCC1(CCOCC1)N
Found 3 products.