CymitQuimica logo

CAS 885270-84-8

:

2,6-Diazaspiro[3.4]octane-2-carboxylicacid, 1,1-dimethylethyl ester

Description:
2,6-Diazaspiro[3.4]octane-2-carboxylic acid, 1,1-dimethylethyl ester, identified by its CAS number 885270-84-8, is a chemical compound characterized by its unique spirocyclic structure, which incorporates two nitrogen atoms within a bicyclic framework. This compound features a carboxylic acid moiety that is esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the diaza group contributes to its basicity and may affect its reactivity in various chemical environments. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological properties. They may exhibit a range of biological activities, including antimicrobial or antitumor effects, depending on their specific structural features and substituents. Additionally, the stability and solubility of this ester derivative can be influenced by the bulky tert-butyl group, which may also play a role in modulating interactions with biological targets. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.
Formula:C11H20N2O2
InChI:InChI=1S/C11H20N2O2/c1-10(2,3)15-9(14)13-7-11(8-13)4-5-12-6-11/h12H,4-8H2,1-3H3
InChI key:UJIOQJJFPYXAEM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC2(C1)CCNC2
Synonyms:
  • 2,6-Diazaspiro[3.4]octane-2-carboxylicacid tert-butyl ester
  • tert-Butyl 2,6-diazaspiro[3.4]octane-2-carboxylate
Found 6 products.