CymitQuimica logo

CAS 885271-63-6

:

Methyl 3-bromo-1H-indazole-4-carboxylate

Description:
Methyl 3-bromo-1H-indazole-4-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a bromine atom at the 3-position of the indazole ring introduces notable reactivity and influences the compound's physical and chemical properties. The carboxylate functional group at the 4-position, along with the methyl ester group, contributes to its solubility in organic solvents and potential for further chemical modifications. This compound is often utilized in medicinal chemistry and research due to its biological activity and ability to serve as a building block for synthesizing more complex molecules. Its molecular structure allows for various interactions, making it a candidate for studies in drug development and other applications in organic synthesis. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts associated with halogenated substances.
Formula:C9H7BrN2O2
InChI:InChI=1/C9H7BrN2O2/c1-14-9(13)5-3-2-4-6-7(5)8(10)12-11-6/h2-4H,1H3,(H,11,12)
InChI key:YRCSUTRLSRFUKC-UHFFFAOYSA-N
SMILES:COC(=O)c1cccc2c1c(Br)n[nH]2
Synonyms:
  • 1H-indazole-4-carboxylic acid, 3-bromo-, methyl ester
  • Methyl 3-bromo-4-indazolecarboxylate
  • Methyl-3-bromoindazole-4-carboxylate
Found 4 products.