CymitQuimica logo

CAS 885272-13-9

:

5-amino-1H-indazole-7-carboxylic acid

Description:
5-Amino-1H-indazole-7-carboxylic acid is a chemical compound characterized by its indazole core, which features an amino group at the 5-position and a carboxylic acid group at the 7-position. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and methanol, owing to the presence of the carboxylic acid functional group. It exhibits properties typical of amino acids, including the ability to participate in hydrogen bonding due to its amino and carboxylic acid functionalities. The compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential biological activities. It may serve as a building block for the synthesis of more complex molecules or as a research tool in studies related to indazole derivatives. Additionally, its structural features suggest potential interactions with biological targets, making it a candidate for further investigation in drug development.
Formula:C8H7N3O2
InChI:InChI=1/C8H7N3O2/c9-5-1-4-3-10-11-7(4)6(2-5)8(12)13/h1-3H,9H2,(H,10,11)(H,12,13)
InChI key:PMABGGGOKOFJCK-UHFFFAOYSA-N
SMILES:c1c2cn[nH]c2c(cc1N)C(=O)O
Synonyms:
  • 5-Amino-1H-indazole-7-carboxylic acid
Found 3 products.