CymitQuimica logo

CAS 885273-75-6

:

tert-butyl N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbamate

Description:
Tert-butyl N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbamate is a chemical compound characterized by its unique structure, which includes a tert-butyl group and a tetrahydroisoquinoline moiety. This compound typically exhibits properties associated with carbamates, such as moderate solubility in organic solvents and potential reactivity with nucleophiles due to the presence of the carbamate functional group. The tetrahydroisoquinoline structure contributes to its biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also display specific stereochemical configurations, influencing its interaction with biological targets. Its molecular weight, boiling point, and melting point are determined by its specific structural features, which can affect its stability and reactivity under various conditions. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound represents a blend of structural complexity and potential utility in chemical and pharmaceutical applications.
Formula:C14H20N2O2
InChI:InChI=1/C14H20N2O2/c1-14(2,3)18-13(17)16-12-5-4-11-9-15-7-6-10(11)8-12/h4-5,8,15H,6-7,9H2,1-3H3,(H,16,17)
InChI key:MHRATZZZIMQAPX-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)Nc1ccc2CNCCc2c1
Synonyms:
  • tert-Butyl 1,2,3,4-tetrahydroisoquinolin-6-ylcarbamate
  • (1,2,3,4-Tetrahydro-Isoquinolin-6-Yl)-Carbamic Acid Tert-Butyl Ester
Found 3 products.