CymitQuimica logo

CAS 885275-50-3

:

Ethyl 6-cyano-3-iodoimidazo[1,2-a]pyridine-2-carboxylate

Description:
Ethyl 6-cyano-3-iodoimidazo[1,2-a]pyridine-2-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes an imidazo[1,2-a]pyridine core. This compound features a cyano group and an iodine atom, contributing to its reactivity and potential applications in medicinal chemistry. The ethyl ester functional group enhances its solubility and bioavailability, making it of interest in drug development. The presence of the cyano group may impart unique electronic properties, while the iodine atom can facilitate various chemical transformations, including nucleophilic substitutions. This compound is likely to exhibit interesting biological activities, which can be explored in the context of pharmacology. Its synthesis and characterization would typically involve standard organic chemistry techniques, including nucleophilic substitution and cyclization reactions. Overall, Ethyl 6-cyano-3-iodoimidazo[1,2-a]pyridine-2-carboxylate represents a valuable scaffold for further research in the development of novel therapeutic agents.
Formula:C11H8IN3O2
InChI:InChI=1S/C11H8IN3O2/c1-2-17-11(16)9-10(12)15-6-7(5-13)3-4-8(15)14-9/h3-4,6H,2H2,1H3
InChI key:InChIKey=YSUULCMRDKEJOX-UHFFFAOYSA-N
SMILES:IC=1N2C(=NC1C(OCC)=O)C=CC(C#N)=C2
Synonyms:
  • 6-Cyano-3-Iodo-Imidazo[1,2-A]Pyridine-2-Carboxylic Acid Ethyl Ester
  • Ethyl 6-cyano-3-iodoimidazo[1,2-a]pyridine-2-carboxylate
  • Imidazo[1,2-a]pyridine-2-carboxylic acid, 6-cyano-3-iodo-, ethyl ester
Found 3 products.