CymitQuimica logo

CAS 885278-98-8

:

Ethyl 7-methoxy-1H-indazole-3-carboxylate

Description:
Ethyl 7-methoxy-1H-indazole-3-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethyl ester functional group at the carboxylic acid position, contributing to its solubility and reactivity. The presence of a methoxy group at the 7-position of the indazole ring enhances its electronic properties and may influence its biological activity. Ethyl 7-methoxy-1H-indazole-3-carboxylate is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the indazole moiety's known biological activities. Additionally, the compound may be of interest in research related to synthetic organic chemistry, where its derivatives could be synthesized for various applications. As with any chemical substance, proper handling and safety precautions should be observed, especially in laboratory settings.
Formula:C11H12N2O3
InChI:InChI=1S/C11H12N2O3/c1-3-16-11(14)10-7-5-4-6-8(15-2)9(7)12-13-10/h4-6H,3H2,1-2H3,(H,12,13)
InChI key:InChIKey=ZFBHKJGLDLREGI-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C=2C(=C(OC)C=CC2)NN1
Synonyms:
  • 1H-Indazole-3-carboxylic acid, 7-methoxy-, ethyl ester
  • Ethyl 7-Methoxy-1H-Indazole-3-Carboxylate
Found 2 products.