CAS 88550-16-7
:1H-Pyrazole-3-acetic acid, 2,5-dihydro-5-oxo-, ethyl ester
Description:
1H-Pyrazole-3-acetic acid, 2,5-dihydro-5-oxo-, ethyl ester, with CAS number 88550-16-7, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features an acetic acid moiety, contributing to its acidic properties, and an ethyl ester functional group, which enhances its solubility in organic solvents. The presence of the 2,5-dihydro-5-oxo group indicates that it has a ketone functionality, which can influence its reactivity and potential applications. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The molecular structure allows for various interactions, such as hydrogen bonding and dipole-dipole interactions, which can affect its behavior in different environments. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and related fields, although specific applications would depend on further research and characterization.
Formula:C7H10N2O3
InChI:InChI=1S/C7H10N2O3/c1-2-12-7(11)4-5-3-6(10)9-8-5/h3H,2,4H2,1H3,(H2,8,9,10)
InChI key:PQKVTISYHNBZSE-UHFFFAOYSA-N
SMILES:CCOC(=O)CC1=CC(=O)NN1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Pyrazole-3-acetic acid, 2,5-dihydro-5-oxo-, ethyl ester
CAS:Formula:C7H10N2O3Molecular weight:170.1659
