CymitQuimica logo

CAS 88550-17-8

:

Pyrano[2,3-c]pyrazole-3-acetic acid, 1,6-dihydro-4-methyl-6-oxo-

Description:
Pyrano[2,3-c]pyrazole-3-acetic acid, 1,6-dihydro-4-methyl-6-oxo- (CAS 88550-17-8) is a heterocyclic organic compound characterized by its unique fused ring structure, which combines a pyran and pyrazole moiety. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. Its structure includes a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of the methyl and keto groups enhances its chemical stability and may influence its pharmacological properties. Pyrano[2,3-c]pyrazole derivatives are often investigated for their potential as anti-inflammatory, analgesic, or antitumor agents. The compound's solubility, melting point, and other physical properties can vary based on its specific formulation and purity. Overall, this compound represents a class of bioactive molecules with promising applications in drug development and therapeutic research.
Formula:C9H8N2O4
InChI:InChI=1S/C9H8N2O4/c1-4-2-7(14)15-9-8(4)5(10-11-9)3-6(12)13/h2H,3H2,1H3,(H,10,11)(H,12,13)
InChI key:FEZSOPWIURQLEA-UHFFFAOYSA-N
SMILES:CC1=CC(=O)OC2=NNC(=C12)CC(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.