CymitQuimica logo

CAS 88550-22-5

:

Bicyclo[2.2.1]hept-2-ene-2-carboxylic acid, 3-[(acetyloxy)methyl]-

Description:
Bicyclo[2.2.1]hept-2-ene-2-carboxylic acid, 3-[(acetyloxy)methyl]- is a bicyclic organic compound characterized by its unique bicyclic structure, which consists of a seven-membered ring system. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit acidic properties. The acetyloxy group suggests that the compound can undergo esterification reactions, making it potentially reactive in organic synthesis. This compound may also exhibit stereochemical features due to the presence of multiple chiral centers, influencing its reactivity and interactions with biological systems. Its bicyclic nature can contribute to its rigidity and influence its physical properties, such as boiling and melting points. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in the synthesis of more complex molecules, given the functional groups present. Overall, the structural features of this compound suggest a range of potential chemical behaviors and applications in various fields of chemistry.
Formula:C11H14O4
InChI:InChI=1S/C11H14O4/c1-6(12)15-5-9-7-2-3-8(4-7)10(9)11(13)14/h7-8H,2-5H2,1H3,(H,13,14)
InChI key:BRSZVSVJESUYCF-UHFFFAOYSA-N
SMILES:CC(=O)OCC1=C(C2CCC1C2)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.