CymitQuimica logo

CAS 885522-12-3

:

6-Chloro-1H-indazole-4-carboxylic acid

Description:
6-Chloro-1H-indazole-4-carboxylic acid is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a chlorine atom at the 6-position and a carboxylic acid group at the 4-position contributes to its unique reactivity and potential applications. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for carboxylic acids. Its molecular structure allows for various functionalization possibilities, making it of interest in medicinal chemistry and drug development. The chlorine substituent can influence the compound's biological activity, potentially enhancing its pharmacological properties. Additionally, the carboxylic acid group can participate in hydrogen bonding, affecting its interactions with biological targets. Overall, 6-Chloro-1H-indazole-4-carboxylic acid is a valuable compound for research, particularly in the fields of organic synthesis and pharmaceutical development.
Formula:C8H5ClN2O2
InChI:InChI=1S/C8H5ClN2O2/c9-4-1-5(8(12)13)6-3-10-11-7(6)2-4/h1-3H,(H,10,11)(H,12,13)
InChI key:InChIKey=ZGMHPRZUHXSOTF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(=CC(Cl)=C1)NN=C2
Synonyms:
  • 1H-Indazole-4-carboxylic acid, 6-chloro-
  • 6-Chloro-1H-indazole-4-carboxylic acid
Found 4 products.