CymitQuimica logo

CAS 885559-69-3

:

N-(2-amino-4-methyl-phenyl)cyclohexanecarboxamide

Description:
N-(2-amino-4-methyl-phenyl)cyclohexanecarboxamide, identified by its CAS number 885559-69-3, is a chemical compound characterized by its amide functional group, which is formed from the reaction of a carboxylic acid and an amine. This compound features a cyclohexane ring, which contributes to its cyclic structure and may influence its physical properties, such as solubility and boiling point. The presence of the 2-amino-4-methylphenyl group introduces both amino and methyl substituents, which can affect the compound's reactivity and potential biological activity. Typically, compounds of this nature may exhibit moderate to high polarity due to the amide and amino groups, potentially making them soluble in polar solvents. Additionally, the structural features suggest that it may engage in hydrogen bonding, influencing its interactions in biological systems. Overall, this compound may have applications in medicinal chemistry or as a building block in organic synthesis, although specific biological activities would require further investigation.
Formula:C14H20N2O
InChI:InChI=1/C14H20N2O/c1-10-7-8-13(12(15)9-10)16-14(17)11-5-3-2-4-6-11/h7-9,11H,2-6,15H2,1H3,(H,16,17)
InChI key:HBIBFKINUYCIMG-UHFFFAOYSA-N
SMILES:Cc1ccc(c(c1)N)N=C(C1CCCCC1)O
Synonyms:
  • cyclohexanecarboxamide, N-(2-amino-4-methylphenyl)-
Found 1 products.