CymitQuimica logo

CAS 88556-18-7

:

L-Phenylalanine, N-[3-(4-methylphenyl)-1-oxo-2-propenyl]-

Description:
L-Phenylalanine, N-[3-(4-methylphenyl)-1-oxo-2-propenyl]- is a compound that belongs to the class of amino acids, specifically a derivative of phenylalanine. It features a phenylalanine backbone, which is an essential amino acid important for protein synthesis and neurotransmitter production. The compound is characterized by the presence of a propenyl group substituted at the nitrogen atom, along with a 4-methylphenyl moiety, which contributes to its unique chemical properties. This structure may influence its biological activity, potentially affecting its interaction with various receptors or enzymes. The compound is likely to exhibit solubility in organic solvents and may have specific applications in pharmaceuticals or biochemistry, particularly in studies related to amino acid metabolism or as a potential therapeutic agent. As with many amino acid derivatives, it may also be subject to various forms of stereochemistry, which can impact its biological function. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C19H19NO3
InChI:InChI=1S/C19H19NO3/c1-14-7-9-15(10-8-14)11-12-18(21)20-17(19(22)23)13-16-5-3-2-4-6-16/h2-12,17H,13H2,1H3,(H,20,21)(H,22,23)/t17-/m0/s1
InChI key:SQPAHKGMRNTZFK-KRWDZBQOSA-N
SMILES:CC1=CC=C(C=C1)C=CC(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O
Found 1 products.