CymitQuimica logo

CAS 88556-19-8

:

L-Phenylalanine, N-[1-oxo-3-[4-(trifluoromethyl)phenyl]-2-propenyl]-

Description:
L-Phenylalanine, N-[1-oxo-3-[4-(trifluoromethyl)phenyl]-2-propenyl]- is a synthetic compound that features a phenylalanine backbone modified with a propenyl group and a trifluoromethyl-substituted phenyl moiety. This compound is characterized by its unique structural components, which include an amino acid structure (phenylalanine) and a conjugated system due to the propenyl group, potentially imparting interesting electronic and steric properties. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's reactivity and biological activity. As a result, this compound may exhibit specific interactions in biological systems, making it of interest in pharmaceutical and biochemical research. Its CAS number, 88556-19-8, allows for precise identification in chemical databases. Overall, the combination of these functional groups suggests potential applications in medicinal chemistry, particularly in the design of novel therapeutic agents. However, detailed studies would be necessary to fully understand its properties and potential uses.
Formula:C19H16F3NO3
InChI:InChI=1S/C19H16F3NO3/c20-19(21,22)15-9-6-13(7-10-15)8-11-17(24)23-16(18(25)26)12-14-4-2-1-3-5-14/h1-11,16H,12H2,(H,23,24)(H,25,26)/t16-/m0/s1
InChI key:NAXOSNKRMZBQIF-INIZCTEOSA-N
SMILES:C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)C=CC2=CC=C(C=C2)C(F)(F)F
Found 1 products.