CAS 88556-77-8
:L-Glutamic acid, N-[N-(1-oxobutyl)-L-valyl]-
Description:
L-Glutamic acid, N-[N-(1-oxobutyl)-L-valyl]- is a synthetic compound that belongs to the class of amino acids and peptides. It is characterized by the presence of both L-glutamic acid and a valyl residue, which contributes to its structural complexity. This compound typically exhibits properties associated with amino acids, such as being soluble in water due to its polar functional groups. The presence of the 1-oxobutyl moiety suggests that it may have specific biological activities or functions, potentially influencing its interaction with biological systems. As a derivative of L-glutamic acid, it may participate in various biochemical pathways, including protein synthesis and neurotransmission. The CAS number 88556-77-8 uniquely identifies this compound in chemical databases, facilitating its study and application in research and industry. Overall, this compound's unique structure may confer specific properties that are of interest in fields such as biochemistry, pharmacology, and nutrition.
Formula:C14H24N2O6
InChI:InChI=1S/C14H24N2O6/c1-4-5-10(17)16-12(8(2)3)13(20)15-9(14(21)22)6-7-11(18)19/h8-9,12H,4-7H2,1-3H3,(H,15,20)(H,16,17)(H,18,19)(H,21,22)/t9-,12-/m0/s1
InChI key:JGLOWVSEUOWYQS-CABZTGNLSA-N
SMILES:CCCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
