CymitQuimica logo

CAS 88556-79-0

:

L-Glutamic acid, N-[N-(1-oxooctyl)-L-valyl]-

Description:
L-Glutamic acid, N-[N-(1-oxooctyl)-L-valyl]- is a synthetic compound that belongs to the class of amino acids and peptides. It is characterized by the presence of a glutamic acid backbone, which is an important neurotransmitter in the central nervous system, and is involved in various metabolic processes. The compound features a unique side chain that includes a valyl group and an octanoyl moiety, which may influence its solubility and biological activity. Typically, such compounds are studied for their potential applications in pharmaceuticals, particularly in drug delivery systems or as bioactive agents. The presence of the octanoyl group may enhance lipophilicity, potentially affecting membrane permeability and interaction with biological targets. As with many amino acid derivatives, the compound may exhibit specific stereochemistry, which can be crucial for its biological function. Overall, L-Glutamic acid, N-[N-(1-oxooctyl)-L-valyl]- represents a complex structure that combines features of both amino acids and fatty acids, making it of interest in medicinal chemistry and biochemistry.
Formula:C18H32N2O6
InChI:InChI=1S/C18H32N2O6/c1-4-5-6-7-8-9-14(21)20-16(12(2)3)17(24)19-13(18(25)26)10-11-15(22)23/h12-13,16H,4-11H2,1-3H3,(H,19,24)(H,20,21)(H,22,23)(H,25,26)/t13-,16-/m0/s1
InChI key:UNAAPJASLNJSPT-BBRMVZONSA-N
SMILES:CCCCCCCC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)O
Found 1 products.