CAS 88557-03-3
:1-Buten-1-amine, N,N-dipropyl-
Description:
1-Buten-1-amine, N,N-dipropyl- is an organic compound characterized by its amine functional group and a butene backbone. It features a double bond between the first and second carbon atoms of the butene chain, which contributes to its reactivity and potential applications in organic synthesis. The presence of two propyl groups attached to the nitrogen atom classifies it as a dipropyl amine, enhancing its hydrophobic properties and influencing its solubility in organic solvents. This compound is likely to exhibit basicity due to the amine group, allowing it to participate in various chemical reactions, including nucleophilic substitutions and polymerization processes. Its structure suggests potential uses in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Additionally, the presence of the double bond may allow for further functionalization, making it a versatile intermediate in chemical synthesis. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H21N
InChI:InChI=1S/C10H21N/c1-4-7-10-11(8-5-2)9-6-3/h7,10H,4-6,8-9H2,1-3H3
InChI key:WWOOWPONZPEAJF-UHFFFAOYSA-N
SMILES:CCCN(CCC)C=CCC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
