CymitQuimica logo

CAS 88557-06-6

:

Ethanone, 1-[5-(diethylamino)-4,5-dihydro-2-methyl-4-propyl-3-furanyl]-

Description:
Ethanone, 1-[5-(diethylamino)-4,5-dihydro-2-methyl-4-propyl-3-furanyl]- is a chemical compound characterized by its complex structure, which includes a furan ring and a diethylamino group. This compound is part of a class of substances known for their potential pharmacological properties. Typically, compounds with such structures may exhibit various biological activities, including neuroactivity or other interactions with biological systems. The presence of the diethylamino group suggests that it may have basic properties, potentially influencing its solubility and reactivity. The furan moiety can contribute to the compound's stability and reactivity, making it of interest in medicinal chemistry. Additionally, the presence of multiple alkyl groups, such as propyl and methyl, can affect the lipophilicity of the molecule, which is crucial for its absorption and distribution in biological systems. Overall, this compound's unique structural features may lead to diverse applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C14H25NO2
InChI:InChI=1S/C14H25NO2/c1-6-9-12-13(10(4)16)11(5)17-14(12)15(7-2)8-3/h12,14H,6-9H2,1-5H3
InChI key:VPCYQMIUFPVDIT-UHFFFAOYSA-N
SMILES:CCCC1C(OC(=C1C(=O)C)C)N(CC)CC
Found 1 products.