CymitQuimica logo

CAS 88557-19-1

:

3-Quinolinecarboxamide, 1,4,4a,5,6,7-hexahydro-1,5-dimethyl-4-oxo-

Description:
3-Quinolinecarboxamide, 1,4,4a,5,6,7-hexahydro-1,5-dimethyl-4-oxo- is a chemical compound characterized by its complex bicyclic structure, which includes a quinoline moiety and a carboxamide functional group. This compound typically exhibits properties associated with both heterocyclic and amide functionalities, such as potential biological activity and solubility in organic solvents. The presence of multiple methyl groups and a ketone contributes to its unique reactivity and stability. It may be of interest in medicinal chemistry due to its structural features that could interact with biological targets. Additionally, the hexahydro component indicates that the compound is saturated, which can influence its physical properties, such as melting point and boiling point. The compound's CAS number, 88557-19-1, allows for precise identification in chemical databases and literature. Overall, this substance may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c1-7-4-3-5-9-10(7)11(15)8(12(13)16)6-14(9)2/h5-7,10H,3-4H2,1-2H3,(H2,13,16)
InChI key:LQPBZVIHYDZAJE-UHFFFAOYSA-N
SMILES:CC1CCC=C2C1C(=O)C(=CN2C)C(=O)N
Found 1 products.