CymitQuimica logo

CAS 88557-20-4

:

2(3H)-Furanone, dihydro-4-[[[(4-methylphenyl)sulfonyl]oxy]methyl]-, (R)-

Description:
2(3H)-Furanone, dihydro-4-[[[(4-methylphenyl)sulfonyl]oxy]methyl]-, (R)-, with CAS number 88557-20-4, is an organic compound characterized by its furanone structure, which includes a five-membered lactone ring. This compound features a sulfonate group attached to a methylphenyl moiety, contributing to its potential as a sulfonyl-containing compound. The presence of the dihydro group indicates that it has undergone hydrogenation, resulting in a saturated form of the furanone. The (R)- designation signifies its specific stereochemistry, which can influence its biological activity and interactions. This compound may exhibit properties such as solubility in organic solvents and potential reactivity due to the functional groups present. Its applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and chemical reactivity. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the sulfonyl group, which can affect toxicity and environmental impact.
Formula:C12H14O5S
InChI:InChI=1S/C12H14O5S/c1-9-2-4-11(5-3-9)18(14,15)17-8-10-6-12(13)16-7-10/h2-5,10H,6-8H2,1H3/t10-/m1/s1
InChI key:RFAIYHKOGYQKLB-SNVBAGLBSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2CC(=O)OC2
Found 1 products.