CymitQuimica logo

CAS 88557-27-1

:

4H-1,3-Benzodioxin-5-methanol, 8-chloro-2,2-dimethyl-

Description:
4H-1,3-Benzodioxin-5-methanol, 8-chloro-2,2-dimethyl- is a chemical compound characterized by its unique structure, which includes a benzodioxin core and various functional groups. This compound features a methanol group at the 5-position and a chloro substituent at the 8-position, along with two methyl groups at the 2-position of the benzodioxin ring. The presence of these substituents contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The chloro group can enhance the compound's biological activity, while the methanol group may influence its solubility and interaction with biological systems. As with many organic compounds, its properties such as melting point, boiling point, and solubility can vary based on environmental conditions and the presence of other substances. Safety data and handling precautions are essential when working with this compound, as it may exhibit toxicity or environmental hazards. Overall, 4H-1,3-Benzodioxin-5-methanol, 8-chloro-2,2-dimethyl- is a compound of interest for further research and application development.
Formula:C11H13ClO3
InChI:InChI=1S/C11H13ClO3/c1-11(2)14-6-8-7(5-13)3-4-9(12)10(8)15-11/h3-4,13H,5-6H2,1-2H3
InChI key:OOVFXJCQHGYLIF-UHFFFAOYSA-N
SMILES:CC1(OCC2=C(C=CC(=C2O1)Cl)CO)C
Found 1 products.