CAS 88557-61-3
:1H-Imidazole, 1-[1-(2-chlorophenyl)-1-phenyl-3-butynyl]-
Description:
1H-Imidazole, 1-[1-(2-chlorophenyl)-1-phenyl-3-butynyl]- is a chemical compound characterized by its imidazole core, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features a substituent that includes a 2-chlorophenyl group and a phenyl group attached to a butynyl chain, indicating a complex structure with potential for various interactions. The presence of the chlorine atom suggests that it may exhibit unique electronic properties, potentially influencing its reactivity and biological activity. Imidazole derivatives are known for their roles in pharmaceuticals and biochemistry, often acting as ligands or enzyme inhibitors. The compound's structure may confer specific properties such as solubility, stability, and reactivity, which are critical for its applications in medicinal chemistry or material science. Additionally, the butynyl group may provide sites for further chemical modifications, enhancing its utility in synthetic chemistry. Overall, this compound exemplifies the diverse functionalities that can arise from heterocyclic chemistry.
Formula:C19H15ClN2
InChI:InChI=1S/C19H15ClN2/c1-2-12-19(22-14-13-21-15-22,16-8-4-3-5-9-16)17-10-6-7-11-18(17)20/h1,3-11,13-15H,12H2
InChI key:FXRRCYZLFHOSGB-UHFFFAOYSA-N
SMILES:C#CCC(C1=CC=CC=C1)(C2=CC=CC=C2Cl)N3C=CN=C3
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1H-Imidazole, 1-[1-(2-chlorophenyl)-1-phenyl-3-butynyl]-
CAS:Formula:C19H15ClN2Molecular weight:306.7888
