CymitQuimica logo

CAS 88557-66-8

:

1H-1,2,4-Triazole, 1-(1,1-diphenyl-3-butynyl)-

Description:
1H-1,2,4-Triazole, 1-(1,1-diphenyl-3-butynyl)-, identified by CAS number 88557-66-8, is a chemical compound that features a triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound is characterized by its unique substitution pattern, specifically the presence of a 1,1-diphenyl-3-butynyl group, which contributes to its distinct physical and chemical properties. Typically, triazoles exhibit notable biological activity, making them of interest in pharmaceutical applications, particularly as antifungal agents or in other therapeutic contexts. The presence of the butynyl group may enhance its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the diphenyl moiety can impart stability and affect the compound's interaction with biological targets. Overall, this compound's structure suggests potential utility in medicinal chemistry, although specific applications would depend on further research into its biological activity and pharmacokinetics.
Formula:C18H15N3
InChI:InChI=1S/C18H15N3/c1-2-13-18(21-15-19-14-20-21,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h1,3-12,14-15H,13H2
InChI key:KXAVVRZSEXTROG-UHFFFAOYSA-N
SMILES:C#CCC(C1=CC=CC=C1)(C2=CC=CC=C2)N3C=NC=N3
Found 1 products.