CAS 88557-69-1
:1H-1,2,4-Triazole, 1-[1,1-bis(4-chlorophenyl)-3-butynyl]-
Description:
1H-1,2,4-Triazole, 1-[1,1-bis(4-chlorophenyl)-3-butynyl]- is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a butynyl group substituted with a bis(4-chlorophenyl) moiety, indicating the presence of two chlorinated phenyl groups attached to a carbon chain. The chlorophenyl groups contribute to the compound's lipophilicity and potential biological activity. The triazole ring is known for its role in various pharmaceutical applications, particularly as a scaffold in antifungal and antimicrobial agents. The presence of multiple aromatic rings may enhance the compound's stability and influence its interaction with biological targets. Additionally, the butynyl group introduces a degree of unsaturation, which can affect the compound's reactivity and potential applications in organic synthesis. Overall, this compound's unique structure suggests potential utility in medicinal chemistry and material science, although specific biological activities and properties would require further investigation.
Formula:C18H13Cl2N3
InChI:InChI=1S/C18H13Cl2N3/c1-2-11-18(23-13-21-12-22-23,14-3-7-16(19)8-4-14)15-5-9-17(20)10-6-15/h1,3-10,12-13H,11H2
InChI key:BVTVHKFWGYVYSA-UHFFFAOYSA-N
SMILES:C#CCC(C1=CC=C(C=C1)Cl)(C2=CC=C(C=C2)Cl)N3C=NC=N3
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
1H-1,2,4-Triazole, 1-[1,1-bis(4-chlorophenyl)-3-butynyl]-
CAS:Formula:C18H13Cl2N3Molecular weight:342.2219
