CAS 88557-71-5
:4H-1,2,4-Triazole, 4-[1-(4-chlorophenyl)-1-phenyl-3-butynyl]-
Description:
4H-1,2,4-Triazole, 4-[1-(4-chlorophenyl)-1-phenyl-3-butynyl]- is a chemical compound characterized by its triazole ring, which is a five-membered heterocyclic structure containing three nitrogen atoms. This compound features a substituent that includes a 4-chlorophenyl group and a phenyl group linked through a butynyl chain, contributing to its unique properties. The presence of the triazole moiety suggests potential applications in pharmaceuticals, particularly as a scaffold for antifungal or antimicrobial agents. The chlorophenyl group may enhance lipophilicity and biological activity, while the butynyl chain can influence the compound's reactivity and interaction with biological targets. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may vary depending on the functional groups present. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can impart toxicity. Overall, this compound represents a complex structure with potential applications in medicinal chemistry and material science.
Formula:C18H14ClN3
InChI:InChI=1S/C18H14ClN3/c1-2-12-18(22-13-20-21-14-22,15-6-4-3-5-7-15)16-8-10-17(19)11-9-16/h1,3-11,13-14H,12H2
InChI key:KWXBHKBLJMLHKQ-UHFFFAOYSA-N
SMILES:C#CCC(C1=CC=CC=C1)(C2=CC=C(C=C2)Cl)N3C=NN=C3
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4H-1,2,4-Triazole, 4-[1-(4-chlorophenyl)-1-phenyl-3-butynyl]-
CAS:Formula:C18H14ClN3Molecular weight:307.7769
