CAS 88558-37-6
:Carbamic acid, (4-chlorophenyl)-, 2-[(3-iodo-2-propynyl)oxy]ethyl ester
Description:
Carbamic acid, (4-chlorophenyl)-, 2-[(3-iodo-2-propynyl)oxy]ethyl ester, with CAS number 88558-37-6, is an organic compound characterized by its carbamate functional group, which is derived from carbamic acid. This compound features a 4-chlorophenyl group, indicating the presence of a chlorine atom on a phenyl ring, which can influence its reactivity and biological activity. The structure also includes a 2-[(3-iodo-2-propynyl)oxy]ethyl moiety, suggesting that it has an ether linkage and a propynyl group substituted with iodine, which may enhance its pharmacological properties. The presence of halogens, such as chlorine and iodine, often contributes to the compound's lipophilicity and potential interactions with biological targets. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and agrochemical applications. However, specific properties such as solubility, melting point, and stability would require empirical data for precise characterization.
Formula:C12H11ClINO3
InChI:InChI=1S/C12H11ClINO3/c13-10-2-4-11(5-3-10)15-12(16)18-9-8-17-7-1-6-14/h2-5H,7-9H2,(H,15,16)
InChI key:HEVPBIZYMDKLCY-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1NC(=O)OCCOCC#CI)Cl
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Carbamic acid, (4-chlorophenyl)-, 2-[(3-iodo-2-propynyl)oxy]ethyl ester
CAS:Formula:C12H11ClINO3Molecular weight:379.5781
