CAS 88558-53-6
:Ethanol, 2-[(3-iodo-1-methyl-2-propynyl)oxy]-
Description:
Ethanol, 2-[(3-iodo-1-methyl-2-propynyl)oxy]- is a chemical compound characterized by its ether functional group and an alkyne moiety. The presence of the iodine atom in its structure suggests that it may exhibit unique reactivity, particularly in nucleophilic substitution reactions. This compound is likely to be a colorless liquid at room temperature, with a moderate boiling point typical of similar ethanol derivatives. Its solubility in water is expected due to the hydroxyl group, which can form hydrogen bonds, while the hydrophobic alkyne portion may influence its overall solubility profile. The compound may also possess biological activity, potentially serving as a precursor in organic synthesis or as an intermediate in pharmaceutical applications. Safety considerations should be taken into account due to the presence of iodine, which can be toxic and may pose environmental hazards. Overall, this compound exemplifies the diverse chemistry of halogenated alcohols and their potential utility in various chemical processes.
Formula:C6H9IO2
InChI:InChI=1S/C6H9IO2/c1-6(2-3-7)9-5-4-8/h6,8H,4-5H2,1H3
InChI key:JSZCNAODRKONNP-UHFFFAOYSA-N
SMILES:CC(C#CI)OCCO
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
