CymitQuimica logo

CAS 88558-78-5

:

1H-Imidazole-1-carboxamide, N-propyl-N-[2-(2-pyridinyloxy)ethyl]-

Description:
1H-Imidazole-1-carboxamide, N-propyl-N-[2-(2-pyridinyloxy)ethyl]- is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a carboxamide functional group, contributing to its potential as a polar molecule. The presence of a propyl group and a pyridinyloxyethyl moiety enhances its lipophilicity and may influence its biological activity. The pyridine ring is known for its aromatic properties and ability to participate in various chemical interactions, including hydrogen bonding and coordination with metal ions. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's solubility and stability can be influenced by the functional groups present, which may affect its behavior in biological systems. Overall, 1H-Imidazole-1-carboxamide, N-propyl-N-[2-(2-pyridinyloxy)ethyl]- is a complex molecule with diverse chemical characteristics that warrant further investigation.
Formula:C14H18N4O2
InChI:InChI=1S/C14H18N4O2/c1-2-8-17(14(19)18-9-7-15-12-18)10-11-20-13-5-3-4-6-16-13/h3-7,9,12H,2,8,10-11H2,1H3
InChI key:FOEOUYWCFRMNBF-UHFFFAOYSA-N
SMILES:CCCN(CCOC1=CC=CC=N1)C(=O)N2C=CN=C2
Found 1 products.