CymitQuimica logo

CAS 88558-91-2

:

1-Propanamine, N-[2-[(6-chloro-2-pyridinyl)oxy]ethyl]-

Description:
1-Propanamine, N-[2-[(6-chloro-2-pyridinyl)oxy]ethyl]- is an organic compound characterized by its amine functional group and a pyridine ring substituted with a chlorine atom. This compound features a propanamine backbone, which contributes to its basicity and potential reactivity. The presence of the 6-chloro-2-pyridinyl group introduces specific electronic and steric properties, influencing its interaction with biological systems and other chemical entities. The ether-like linkage (the -O- group) between the pyridine and the ethyl chain enhances its solubility in organic solvents and may affect its pharmacokinetic properties. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including agrochemicals and pharmaceuticals. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C10H15ClN2O
InChI:InChI=1S/C10H15ClN2O/c1-2-6-12-7-8-14-10-5-3-4-9(11)13-10/h3-5,12H,2,6-8H2,1H3
InChI key:PAPHTFBCPFNENP-UHFFFAOYSA-N
SMILES:CCCNCCOC1=NC(=CC=C1)Cl
Found 1 products.