CymitQuimica logo

CAS 885588-03-4

:

4-Pyridinecarboxylic acid, 3-[(2-fluoro-4-iodophenyl)amino]-

Description:
4-Pyridinecarboxylic acid, 3-[(2-fluoro-4-iodophenyl)amino]- is a chemical compound characterized by its pyridine and carboxylic acid functional groups, along with an amino group substituted on the aromatic ring. This compound features a fluorine and iodine substituent on the phenyl ring, which can influence its reactivity and biological activity. The presence of the carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, while the amino group can participate in various interactions, making it a candidate for pharmaceutical applications. The halogen substituents (fluorine and iodine) may enhance lipophilicity and alter the electronic properties of the molecule, potentially affecting its binding affinity to biological targets. Additionally, the compound's structure suggests it may exhibit interesting properties in terms of solubility and stability, which are crucial for its application in medicinal chemistry and drug design. Overall, this compound's unique combination of functional groups and substituents makes it a subject of interest in research and development.
Formula:C12H8FIN2O2
InChI:InChI=1S/C12H8FIN2O2/c13-9-5-7(14)1-2-10(9)16-11-6-15-4-3-8(11)12(17)18/h1-6,16H,(H,17,18)
InChI key:LKJJUICFLVYDJQ-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1I)F)NC2=C(C=CN=C2)C(=O)O
Found 4 products.