CAS 88559-27-7
:1H-[1,3]Dithiolo[4,5-c]pyrazole-5-thione, 3-amino-
Description:
1H-[1,3]Dithiolo[4,5-c]pyrazole-5-thione, 3-amino- (CAS 88559-27-7) is a heterocyclic compound characterized by its unique structure that includes a pyrazole ring fused with a dithiolo moiety. This compound typically exhibits properties associated with both sulfur and nitrogen-containing heterocycles, such as potential reactivity in nucleophilic substitution reactions due to the presence of the thiol group. The amino group contributes to its basicity and can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The compound may display biological activity, making it of interest in medicinal chemistry and material science. Its stability, solubility, and reactivity can vary depending on the solvent and environmental conditions. Additionally, the presence of sulfur in its structure may impart unique electronic properties, potentially allowing for applications in organic synthesis or as a ligand in coordination chemistry. Overall, this compound represents a fascinating area of study within the realm of heterocyclic chemistry.
Formula:C4H3N3S3
InChI:InChI=1S/C4H3N3S3/c5-2-1-3(7-6-2)10-4(8)9-1/h(H3,5,6,7)
InChI key:FEHOPJKPNNDMCK-UHFFFAOYSA-N
SMILES:C12=C(NN=C1SC(=S)S2)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
