CymitQuimica logo

CAS 88559-28-8

:

Thiopyrylium, 4-(3-methylphenyl)-2,6-diphenyl-

Description:
Thiopyrylium, 4-(3-methylphenyl)-2,6-diphenyl- is a member of the thiopyrylium ion family, characterized by a five-membered heterocyclic ring containing a sulfur atom. This compound features a positively charged thiopyrylium core, which is stabilized by resonance due to the presence of substituents on the aromatic rings. The presence of the 3-methylphenyl group and two phenyl groups contributes to its unique electronic properties, enhancing its stability and reactivity. Thiopyrylium ions are known for their role in various organic reactions, including electrophilic aromatic substitution and as intermediates in synthetic pathways. The compound's solubility and reactivity can be influenced by the substituents on the aromatic rings, which can affect its electronic distribution. Additionally, thiopyrylium compounds often exhibit interesting photophysical properties, making them of interest in materials science and organic electronics. Overall, this compound exemplifies the diverse chemistry of heterocycles and their potential applications in organic synthesis and materials development.
Formula:C24H19S
InChI:InChI=1S/C24H19S/c1-18-9-8-14-21(15-18)22-16-23(19-10-4-2-5-11-19)25-24(17-22)20-12-6-3-7-13-20/h2-17H,1H3/q+1
InChI key:ATWVHDDSXQDGDS-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)C2=CC(=[S+]C(=C2)C3=CC=CC=C3)C4=CC=CC=C4
Found 1 products.