CAS 88559-29-9
:Thiopyrylium, 2,4,6-tris(4-bromophenyl)-
Description:
Thiopyrylium, 2,4,6-tris(4-bromophenyl)- is a heterocyclic compound characterized by a five-membered ring containing a sulfur atom and a positively charged thiopyrylium ion. This compound features three 4-bromophenyl substituents, which enhance its electronic properties and stability. The presence of bromine atoms introduces significant electronegativity, influencing the compound's reactivity and potential applications in organic synthesis and materials science. Thiopyrylium salts are known for their ability to act as strong electrophiles, making them useful in various chemical reactions, including nucleophilic substitutions and cycloadditions. The compound's unique structure contributes to its potential utility in the development of dyes, pigments, and as intermediates in organic synthesis. Additionally, the stability and reactivity of thiopyrylium derivatives can be modulated by varying the substituents on the aromatic rings, allowing for tailored properties for specific applications. Overall, this compound exemplifies the intriguing chemistry of thiopyrylium derivatives and their relevance in advanced materials and organic chemistry.
Formula:C23H14Br3S
InChI:InChI=1S/C23H14Br3S/c24-19-7-1-15(2-8-19)18-13-22(16-3-9-20(25)10-4-16)27-23(14-18)17-5-11-21(26)12-6-17/h1-14H/q+1
InChI key:CARJUKLRBBSACF-UHFFFAOYSA-N
SMILES:C1=CC(=CC=C1C2=CC(=[S+]C(=C2)C3=CC=C(C=C3)Br)C4=CC=C(C=C4)Br)Br
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
