CAS 88559-37-9
:1-Decanone, 1-(8-hydroxy-5-quinolinyl)-
Description:
1-Decanone, 1-(8-hydroxy-5-quinolinyl)-, with the CAS number 88559-37-9, is a chemical compound that features a decanone backbone, which is a ketone with a ten-carbon chain, and a quinoline derivative that includes a hydroxyl group. This compound is characterized by its structural complexity, combining the properties of both aliphatic ketones and aromatic heterocycles. The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may influence its reactivity, particularly in hydrogen bonding interactions. The quinoline moiety can impart biological activity, making this compound of interest in medicinal chemistry and research. Additionally, the length of the aliphatic chain may affect its physical properties, such as boiling point and volatility. Overall, this compound's unique structure suggests potential applications in various fields, including pharmaceuticals and materials science, although specific applications would depend on further research into its properties and behavior in different environments.
Formula:C19H25NO2
InChI:InChI=1S/C19H25NO2/c1-2-3-4-5-6-7-8-11-17(21)15-12-13-18(22)19-16(15)10-9-14-20-19/h9-10,12-14,22H,2-8,11H2,1H3
InChI key:CWBIMKYMYUXNNW-UHFFFAOYSA-N
SMILES:CCCCCCCCCC(=O)C1=C2C=CC=NC2=C(C=C1)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
