CymitQuimica logo

CAS 88559-44-8

:

1-Decanone, 1-(8-hydroxy-7-quinolinyl)-, hydrazone

Description:
1-Decanone, 1-(8-hydroxy-7-quinolinyl)-, hydrazone, identified by CAS number 88559-44-8, is a chemical compound that features a hydrazone functional group, which is formed by the reaction of a hydrazine with a carbonyl compound. This substance is characterized by its unique structure that includes a decanone moiety and a quinoline derivative, contributing to its potential biological activity. Typically, compounds of this nature may exhibit properties such as antimicrobial, antifungal, or antitumor activities, although specific biological effects would depend on the context of its use and the presence of substituents. The presence of the hydrazone linkage often enhances the compound's stability and solubility in various solvents. Additionally, the compound may have applications in organic synthesis, pharmaceuticals, or as a ligand in coordination chemistry. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact can vary based on concentration and exposure.
Formula:C19H27N3O
InChI:InChI=1S/C19H27N3O/c1-2-3-4-5-6-7-8-11-17(22-20)16-13-12-15-10-9-14-21-18(15)19(16)23/h9-10,12-14,23H,2-8,11,20H2,1H3/b22-17+
InChI key:WBHRECSKSULLIM-OQKWZONESA-N
SMILES:CCCCCCCCC/C(=N\N)/C1=C(C2=C(C=CC=N2)C=C1)O
Found 1 products.