CymitQuimica logo

CAS 885590-99-8

:

2,3-difluoro-4-iodo-benzaldehyde

Description:
2,3-Difluoro-4-iodo-benzaldehyde is an organic compound characterized by the presence of both fluorine and iodine substituents on a benzaldehyde structure. This compound features a benzene ring with two fluorine atoms located at the 2 and 3 positions and an iodine atom at the 4 position, along with a formyl group (-CHO) that defines its aldehyde functionality. The presence of electronegative halogens like fluorine and iodine significantly influences its chemical reactivity and physical properties, such as polarity and boiling point. Typically, compounds like this exhibit moderate solubility in organic solvents and may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The unique combination of halogens can also affect the compound's electronic properties, making it of interest in synthetic organic chemistry and materials science. Additionally, its structure may lend itself to applications in pharmaceuticals or agrochemicals, where halogenated compounds often play a crucial role in biological activity.
Formula:C7H3F2IO
InChI:InChI=1/C7H3F2IO/c8-6-4(3-11)1-2-5(10)7(6)9/h1-3H
InChI key:NQOUDZZHNAVUHU-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1C=O)F)F)I
Synonyms:
  • 2,3-Difluoro-4-Iodobenzaldehyde
  • Benzaldehyde, 2,3-difluoro-4-iodo-
Found 4 products.