CAS 885595-83-5
:Ethanamine, N,N-diethyl-2-(2,2,2-trifluoroethoxy)-
Description:
Ethanamine, N,N-diethyl-2-(2,2,2-trifluoroethoxy)-, also known by its CAS number 885595-83-5, is an organic compound characterized by its amine functional group and the presence of a trifluoroethoxy substituent. This compound features a diethylamino group, which contributes to its basicity and potential reactivity. The trifluoroethoxy moiety imparts unique properties, including increased lipophilicity and potential biological activity, making it of interest in various chemical and pharmaceutical applications. The presence of fluorine atoms enhances the compound's stability and can influence its interaction with biological systems. Typically, such compounds may exhibit moderate to high solubility in organic solvents, while their solubility in water can vary depending on the overall structure and substituents. Safety data should be consulted for handling and potential hazards, as amines can be irritants and may pose health risks. Overall, this compound's unique structural features make it a subject of interest in synthetic chemistry and drug development.
Formula:C8H16F3NO
InChI:InChI=1S/C8H16F3NO/c1-3-12(4-2)5-6-13-7-8(9,10)11/h3-7H2,1-2H3
InChI key:UWOIAFPZWKUZDX-UHFFFAOYSA-N
SMILES:CCN(CC)CCOCC(F)(F)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
