CymitQuimica logo

CAS 88561-05-1

:

Benzeneacetic acid, 4-(1-butyl-1H-indol-2-yl)-

Description:
Benzeneacetic acid, 4-(1-butyl-1H-indol-2-yl)-, also known by its CAS number 88561-05-1, is an organic compound characterized by its structure, which features a benzene ring substituted with a butyl group and an indole moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to the presence of the hydrophobic butyl group and the polar carboxylic acid functional group. The indole structure may impart additional pharmacological properties, making it of interest in medicinal chemistry. The compound's reactivity is influenced by the presence of the carboxylic acid group, which can participate in various chemical reactions, including esterification and amidation. Overall, benzeneacetic acid derivatives are often studied for their potential applications in pharmaceuticals and agrochemicals, owing to their diverse biological activities and structural versatility.
Formula:C20H21NO2
InChI:InChI=1S/C20H21NO2/c1-2-3-12-21-18-7-5-4-6-17(18)14-19(21)16-10-8-15(9-11-16)13-20(22)23/h4-11,14H,2-3,12-13H2,1H3,(H,22,23)
InChI key:LOGDFSKZPSMVHF-UHFFFAOYSA-N
SMILES:CCCCN1C2=CC=CC=C2C=C1C3=CC=C(C=C3)CC(=O)O
Found 1 products.