CymitQuimica logo

CAS 88561-41-5

:

2,6-Pyridinedicarboxamide, N,N'-dimethyl-4-(phenylamino)-

Description:
2,6-Pyridinedicarboxamide, N,N'-dimethyl-4-(phenylamino)-, with the CAS number 88561-41-5, is an organic compound characterized by its pyridine ring structure substituted with two carboxamide groups and a dimethylamino group attached to a phenylamino moiety. This compound typically exhibits properties such as moderate solubility in polar organic solvents, reflecting its polar functional groups. It may display biological activity, making it of interest in pharmaceutical research. The presence of the pyridine ring contributes to its potential as a ligand in coordination chemistry, while the amide groups can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound's structure suggests potential applications in materials science or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C15H16N4O2
InChI:InChI=1S/C15H16N4O2/c1-16-14(20)12-8-11(9-13(19-12)15(21)17-2)18-10-6-4-3-5-7-10/h3-9H,1-2H3,(H,16,20)(H,17,21)(H,18,19)
InChI key:PHVPJRYDGAGGQG-UHFFFAOYSA-N
SMILES:CNC(=O)C1=CC(=CC(=N1)C(=O)NC)NC2=CC=CC=C2
Found 1 products.