CAS 88561-42-6
:2,6-Pyridinedicarboxamide, 4-amino-N,N'-dimethyl-
Description:
2,6-Pyridinedicarboxamide, 4-amino-N,N'-dimethyl- is an organic compound characterized by its pyridine ring structure, which is substituted with two carboxamide groups at the 2 and 6 positions and an amino group at the 4 position, along with two methyl groups attached to the nitrogen of the amino group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of amide functional groups, which can engage in hydrogen bonding. It may also display moderate stability under standard conditions, although specific stability can depend on environmental factors. The presence of multiple functional groups suggests potential reactivity, particularly in forming derivatives or participating in condensation reactions. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, given its structural features that can influence biological activity. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C9H12N4O2
InChI:InChI=1S/C9H12N4O2/c1-11-8(14)6-3-5(10)4-7(13-6)9(15)12-2/h3-4H,1-2H3,(H2,10,13)(H,11,14)(H,12,15)
InChI key:IKLGPSFIDUJNQF-UHFFFAOYSA-N
SMILES:CNC(=O)C1=CC(=CC(=N1)C(=O)NC)N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
